C22H29NO3 — CID 134934692
methyl (3S,4S)-4-(dibenzylamino)-3-hydroxy-2,2-dimethylpentanoate (PubChem CID 134934692) has the molecular formula C22H29NO3 and a molecular weight of 355.48 g/mol. Its IUPAC name is methyl (3S,4S)-4-(dibenzylamino)-3-hydroxy-2,2-dimethylpentanoate.
| Compound Name | methyl (3S,4S)-4-(dibenzylamino)-3-hydroxy-2,2-dimethylpentanoate |
|---|---|
| PubChem CID | 134934692 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | methyl (3S,4S)-4-(dibenzylamino)-3-hydroxy-2,2-dimethylpentanoate |
| SMILES | COC(=O)C(C)(C)[C@H](O)[C@H](C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C22H29NO3/c1-17(20(24)22(2,3)21(25)26-4)23(15-18-11-7-5-8-12-18)16-19-13-9-6-10-14-19/h5-14,17,20,24H,15-16H2,1-4H3/t17-,20+/m0/s1 |
| InChIKey | OBSOMJAHBSBGQR-FXAWDEMLSA-N |
| XLogP | 3.64 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |