C29H26NO2P — CID 134934926
(2S,3S,5S,6R)-3,5,6-triphenyl-2-[(E)-2-phenylethenyl]-1,4,2λ5-oxazaphosphinane 2-oxide (PubChem CID 134934926) has the molecular formula C29H26NO2P and a molecular weight of 451.51 g/mol. Its IUPAC name is (2S,3S,5S,6R)-3,5,6-triphenyl-2-[(E)-2-phenylethenyl]-1,4,2λ5-oxazaphosphinane 2-oxide.
| Compound Name | (2S,3S,5S,6R)-3,5,6-triphenyl-2-[(E)-2-phenylethenyl]-1,4,2λ5-oxazaphosphinane 2-oxide |
|---|---|
| PubChem CID | 134934926 |
| Molecular Formula | C29H26NO2P |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | (2S,3S,5S,6R)-3,5,6-triphenyl-2-[(E)-2-phenylethenyl]-1,4,2λ5-oxazaphosphinane 2-oxide |
| SMILES | O=[P@@]1(/C=C/c2ccccc2)O[C@H](c2ccccc2)[C@H](c2ccccc2)N[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C29H26NO2P/c31-33(22-21-23-13-5-1-6-14-23)29(26-19-11-4-12-20-26)30-27(24-15-7-2-8-16-24)28(32-33)25-17-9-3-10-18-25/h1-22,27-30H/b22-21+/t27-,28+,29-,33-/m0/s1 |
| InChIKey | WFHPYAXYZSNTOK-QSRQRVBDSA-N |
| XLogP | 7.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|