C26H19Cl2F3O3S2 — CID 134935063
[bis[4-(4-chlorophenyl)phenyl]-methyl-λ4-sulfanyl] trifluoromethanesulfonate (PubChem CID 134935063) has the molecular formula C26H19Cl2F3O3S2 and a molecular weight of 571.47 g/mol. Its IUPAC name is [bis[4-(4-chlorophenyl)phenyl]-methyl-λ4-sulfanyl] trifluoromethanesulfonate.
| Compound Name | [bis[4-(4-chlorophenyl)phenyl]-methyl-λ4-sulfanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134935063 |
| Molecular Formula | C26H19Cl2F3O3S2 |
| Molecular Weight | 571.47 g/mol |
| Exact Mass | 570.01 |
| IUPAC Name | [bis[4-(4-chlorophenyl)phenyl]-methyl-λ4-sulfanyl] trifluoromethanesulfonate |
| SMILES | CS(OS(=O)(=O)C(F)(F)F)(c1ccc(-c2ccc(Cl)cc2)cc1)c1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H19Cl2F3O3S2/c1-35(34-36(32,33)26(29,30)31,24-14-6-20(7-15-24)18-2-10-22(27)11-3-18)25-16-8-21(9-17-25)19-4-12-23(28)13-5-19/h2-17H,1H3 |
| InChIKey | NBILMFZXSCZKAS-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.47 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|