C13H14O7 — CID 134935117
methyl (1S,2R,6R,7R)-5,6-dimethoxy-8-oxo-3,9-dioxatricyclo[5.2.2.02,6]undeca-4,10-diene-10-carboxylate (PubChem CID 134935117) has the molecular formula C13H14O7 and a molecular weight of 282.25 g/mol. Its IUPAC name is methyl (1S,2R,6R,7R)-5,6-dimethoxy-8-oxo-3,9-dioxatricyclo[5.2.2.02,6]undeca-4,10-diene-10-carboxylate.
| Compound Name | methyl (1S,2R,6R,7R)-5,6-dimethoxy-8-oxo-3,9-dioxatricyclo[5.2.2.02,6]undeca-4,10-diene-10-carboxylate |
|---|---|
| PubChem CID | 134935117 |
| Molecular Formula | C13H14O7 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | methyl (1S,2R,6R,7R)-5,6-dimethoxy-8-oxo-3,9-dioxatricyclo[5.2.2.02,6]undeca-4,10-diene-10-carboxylate |
| SMILES | COC(=O)C1=C[C@H]2C(=O)O[C@@H]1[C@H]1OC=C(OC)[C@]12OC |
| InChI | InChI=1S/C13H14O7/c1-16-8-5-19-10-9-6(11(14)17-2)4-7(12(15)20-9)13(8,10)18-3/h4-5,7,9-10H,1-3H3/t7-,9-,10+,13-/m0/s1 |
| InChIKey | MZHZKOBVRGYRRE-OIORRXCASA-N |
| XLogP | -0.09 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |