C19H26O5S — CID 134935162
3-(benzenesulfonyl)-1-(3,4-dihydro-2H-pyran-6-yl)-8-hydroxyoctan-4-one (PubChem CID 134935162) has the molecular formula C19H26O5S and a molecular weight of 366.48 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-1-(3,4-dihydro-2H-pyran-6-yl)-8-hydroxyoctan-4-one.
| Compound Name | 3-(benzenesulfonyl)-1-(3,4-dihydro-2H-pyran-6-yl)-8-hydroxyoctan-4-one |
|---|---|
| PubChem CID | 134935162 |
| Molecular Formula | C19H26O5S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 3-(benzenesulfonyl)-1-(3,4-dihydro-2H-pyran-6-yl)-8-hydroxyoctan-4-one |
| SMILES | O=C(CCCCO)C(CCC1=CCCCO1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H26O5S/c20-14-6-4-11-18(21)19(13-12-16-8-5-7-15-24-16)25(22,23)17-9-2-1-3-10-17/h1-3,8-10,19-20H,4-7,11-15H2 |
| InChIKey | TWYJNQRMDPEKDO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|