C22H19F5NO2P — CID 134935332
N-benzyl-1-[ethoxy-(2,3,4,5,6-pentafluorophenyl)phosphoryl]-1-phenylmethanamine (PubChem CID 134935332) has the molecular formula C22H19F5NO2P and a molecular weight of 455.36 g/mol. Its IUPAC name is N-benzyl-1-[ethoxy-(2,3,4,5,6-pentafluorophenyl)phosphoryl]-1-phenylmethanamine.
| Compound Name | N-benzyl-1-[ethoxy-(2,3,4,5,6-pentafluorophenyl)phosphoryl]-1-phenylmethanamine |
|---|---|
| PubChem CID | 134935332 |
| Molecular Formula | C22H19F5NO2P |
| Molecular Weight | 455.36 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | N-benzyl-1-[ethoxy-(2,3,4,5,6-pentafluorophenyl)phosphoryl]-1-phenylmethanamine |
| SMILES | CCOP(=O)(c1c(F)c(F)c(F)c(F)c1F)C(NCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H19F5NO2P/c1-2-30-31(29,21-19(26)17(24)16(23)18(25)20(21)27)22(15-11-7-4-8-12-15)28-13-14-9-5-3-6-10-14/h3-12,22,28H,2,13H2,1H3 |
| InChIKey | MUHLLSFQLAWOHU-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.36 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|