C14H6Cl5NO4 — CID 134935342
4-(4-carboxy-N,2,6-trichloroanilino)-3,5-dichlorobenzoic acid (PubChem CID 134935342) has the molecular formula C14H6Cl5NO4 and a molecular weight of 429.47 g/mol. Its IUPAC name is 4-(4-carboxy-N,2,6-trichloroanilino)-3,5-dichlorobenzoic acid.
| Compound Name | 4-(4-carboxy-N,2,6-trichloroanilino)-3,5-dichlorobenzoic acid |
|---|---|
| PubChem CID | 134935342 |
| Molecular Formula | C14H6Cl5NO4 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 426.87 |
| IUPAC Name | 4-(4-carboxy-N,2,6-trichloroanilino)-3,5-dichlorobenzoic acid |
| SMILES | O=C(O)c1cc(Cl)c(N(Cl)c2c(Cl)cc(C(=O)O)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H6Cl5NO4/c15-7-1-5(13(21)22)2-8(16)11(7)20(19)12-9(17)3-6(14(23)24)4-10(12)18/h1-4H,(H,21,22)(H,23,24) |
| InChIKey | HXRFTOAAKMVKTQ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|