C13H19F3O4S2 — CID 134935624
(2,2-dimethylpropoxy-methyl-phenyl-λ4-sulfanyl) trifluoromethanesulfonate (PubChem CID 134935624) has the molecular formula C13H19F3O4S2 and a molecular weight of 360.42 g/mol. Its IUPAC name is (2,2-dimethylpropoxy-methyl-phenyl-λ4-sulfanyl) trifluoromethanesulfonate.
| Compound Name | (2,2-dimethylpropoxy-methyl-phenyl-λ4-sulfanyl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134935624 |
| Molecular Formula | C13H19F3O4S2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | (2,2-dimethylpropoxy-methyl-phenyl-λ4-sulfanyl) trifluoromethanesulfonate |
| SMILES | CC(C)(C)COS(C)(OS(=O)(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C13H19F3O4S2/c1-12(2,3)10-19-21(4,11-8-6-5-7-9-11)20-22(17,18)13(14,15)16/h5-9H,10H2,1-4H3 |
| InChIKey | SLLFKOIGAPFVEE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|