C14H27NSi2 — CID 13493569
1-(2-methylphenyl)-N,N-bis(trimethylsilyl)methanamine (PubChem CID 13493569) has the molecular formula C14H27NSi2 and a molecular weight of 265.55 g/mol. Its IUPAC name is 1-(2-methylphenyl)-N,N-bis(trimethylsilyl)methanamine.
| Compound Name | 1-(2-methylphenyl)-N,N-bis(trimethylsilyl)methanamine |
|---|---|
| PubChem CID | 13493569 |
| Molecular Formula | C14H27NSi2 |
| Molecular Weight | 265.55 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 1-(2-methylphenyl)-N,N-bis(trimethylsilyl)methanamine |
| SMILES | Cc1ccccc1CN([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C14H27NSi2/c1-13-10-8-9-11-14(13)12-15(16(2,3)4)17(5,6)7/h8-11H,12H2,1-7H3 |
| InChIKey | UCTOVQQVHQJXKO-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.55 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|