About N-benzyl-N-[iodo(diphenyl)-λ4-sulfanyl]ethanamine
N-benzyl-N-[iodo(diphenyl)-λ4-sulfanyl]ethanamine (PubChem CID 134935867) has the molecular formula C21H22INS
and a molecular weight of 447.39 g/mol. Its IUPAC name is N-benzyl-N-[iodo(diphenyl)-λ4-sulfanyl]ethanamine.
Molecular Properties
| Compound Name | N-benzyl-N-[iodo(diphenyl)-λ4-sulfanyl]ethanamine |
| PubChem CID | 134935867 |
| Molecular Formula | C21H22INS |
| Molecular Weight | 447.39 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | N-benzyl-N-[iodo(diphenyl)-λ4-sulfanyl]ethanamine |
| SMILES | CCN(Cc1ccccc1)S(I)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H22INS/c1-2-23(18-19-12-6-3-7-13-19)24(22,20-14-8-4-9-15-20)21-16-10-5-11-17-21/h3-17H,2,18H2,1H3 |
| InChIKey | BAUIIQYXAXXLMN-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.39 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-N-[iodo(diphenyl)-λ4-sulfanyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N-[iodo(diphenyl)-λ4-sulfanyl]ethanamine?
The IUPAC name of N-benzyl-N-[iodo(diphenyl)-λ4-sulfanyl]ethanamine (CID 134935867) is N-benzyl-N-[iodo(diphenyl)-λ4-sulfanyl]ethanamine.
What is the SMILES notation for N-benzyl-N-[iodo(diphenyl)-λ4-sulfanyl]ethanamine?
The canonical SMILES for N-benzyl-N-[iodo(diphenyl)-λ4-sulfanyl]ethanamine is CCN(Cc1ccccc1)S(I)(c1ccccc1)c1ccccc1.
What is the InChIKey of N-benzyl-N-[iodo(diphenyl)-λ4-sulfanyl]ethanamine?
The InChIKey is BAUIIQYXAXXLMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22INS/c1-2-23(18-19-12-6-3-7-13-19)24(22,20-14-8-4-9-15-20)21-16-10-5-11-17-21/h3-17H,2,18H2,1H3.
What are the key properties of N-benzyl-N-[iodo(diphenyl)-λ4-sulfanyl]ethanamine?
N-benzyl-N-[iodo(diphenyl)-λ4-sulfanyl]ethanamine has a molecular weight of 447.39 g/mol, XLogP of 6.70, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N-[iodo(diphenyl)-λ4-sulfanyl]ethanamine is sourced from PubChem (CID 134935867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).