About 2,4-dimethyl-5-[(2E)-penta-2,4-dienyl]phenol
2,4-dimethyl-5-[(2E)-penta-2,4-dienyl]phenol (PubChem CID 13493591) has the molecular formula C13H16O
and a molecular weight of 188.27 g/mol. Its IUPAC name is 2,4-dimethyl-5-[(2E)-penta-2,4-dienyl]phenol.
Molecular Properties
| Compound Name | 2,4-dimethyl-5-[(2E)-penta-2,4-dienyl]phenol |
| PubChem CID | 13493591 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 2,4-dimethyl-5-[(2E)-penta-2,4-dienyl]phenol |
| SMILES | C=C/C=C/Cc1cc(O)c(C)cc1C |
| InChI | InChI=1S/C13H16O/c1-4-5-6-7-12-9-13(14)11(3)8-10(12)2/h4-6,8-9,14H,1,7H2,2-3H3/b6-5+ |
| InChIKey | UBUXMXAEWNFFTL-AATRIKPKSA-N |
| XLogP | 3.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethyl-5-[(2E)-penta-2,4-dienyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-5-[(2E)-penta-2,4-dienyl]phenol?
The IUPAC name of 2,4-dimethyl-5-[(2E)-penta-2,4-dienyl]phenol (CID 13493591) is 2,4-dimethyl-5-[(2E)-penta-2,4-dienyl]phenol.
What is the SMILES notation for 2,4-dimethyl-5-[(2E)-penta-2,4-dienyl]phenol?
The canonical SMILES for 2,4-dimethyl-5-[(2E)-penta-2,4-dienyl]phenol is C=C/C=C/Cc1cc(O)c(C)cc1C.
What is the InChIKey of 2,4-dimethyl-5-[(2E)-penta-2,4-dienyl]phenol?
The InChIKey is UBUXMXAEWNFFTL-AATRIKPKSA-N. The full InChI is InChI=1S/C13H16O/c1-4-5-6-7-12-9-13(14)11(3)8-10(12)2/h4-6,8-9,14H,1,7H2,2-3H3/b6-5+.
What are the key properties of 2,4-dimethyl-5-[(2E)-penta-2,4-dienyl]phenol?
2,4-dimethyl-5-[(2E)-penta-2,4-dienyl]phenol has a molecular weight of 188.27 g/mol, XLogP of 3.29, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-5-[(2E)-penta-2,4-dienyl]phenol is sourced from PubChem (CID 13493591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).