About N-(2-chloro-4-methylphenyl)-4,5-bis(4-methylphenyl)-1,3-dioxol-2-imine
N-(2-chloro-4-methylphenyl)-4,5-bis(4-methylphenyl)-1,3-dioxol-2-imine (PubChem CID 134935913) has the molecular formula C24H20ClNO2
and a molecular weight of 389.88 g/mol. Its IUPAC name is N-(2-chloro-4-methylphenyl)-4,5-bis(4-methylphenyl)-1,3-dioxol-2-imine.
Molecular Properties
| Compound Name | N-(2-chloro-4-methylphenyl)-4,5-bis(4-methylphenyl)-1,3-dioxol-2-imine |
| PubChem CID | 134935913 |
| Molecular Formula | C24H20ClNO2 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | N-(2-chloro-4-methylphenyl)-4,5-bis(4-methylphenyl)-1,3-dioxol-2-imine |
| SMILES | Cc1ccc(-c2oc(=Nc3ccc(C)cc3Cl)oc2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H20ClNO2/c1-15-4-9-18(10-5-15)22-23(19-11-6-16(2)7-12-19)28-24(27-22)26-21-13-8-17(3)14-20(21)25/h4-14H,1-3H3 |
| InChIKey | UWTFQCCWZCQKDF-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 38.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-chloro-4-methylphenyl)-4,5-bis(4-methylphenyl)-1,3-dioxol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chloro-4-methylphenyl)-4,5-bis(4-methylphenyl)-1,3-dioxol-2-imine?
The IUPAC name of N-(2-chloro-4-methylphenyl)-4,5-bis(4-methylphenyl)-1,3-dioxol-2-imine (CID 134935913) is N-(2-chloro-4-methylphenyl)-4,5-bis(4-methylphenyl)-1,3-dioxol-2-imine.
What is the SMILES notation for N-(2-chloro-4-methylphenyl)-4,5-bis(4-methylphenyl)-1,3-dioxol-2-imine?
The canonical SMILES for N-(2-chloro-4-methylphenyl)-4,5-bis(4-methylphenyl)-1,3-dioxol-2-imine is Cc1ccc(-c2oc(=Nc3ccc(C)cc3Cl)oc2-c2ccc(C)cc2)cc1.
What is the InChIKey of N-(2-chloro-4-methylphenyl)-4,5-bis(4-methylphenyl)-1,3-dioxol-2-imine?
The InChIKey is UWTFQCCWZCQKDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20ClNO2/c1-15-4-9-18(10-5-15)22-23(19-11-6-16(2)7-12-19)28-24(27-22)26-21-13-8-17(3)14-20(21)25/h4-14H,1-3H3.
What are the key properties of N-(2-chloro-4-methylphenyl)-4,5-bis(4-methylphenyl)-1,3-dioxol-2-imine?
N-(2-chloro-4-methylphenyl)-4,5-bis(4-methylphenyl)-1,3-dioxol-2-imine has a molecular weight of 389.88 g/mol, XLogP of 7.02, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chloro-4-methylphenyl)-4,5-bis(4-methylphenyl)-1,3-dioxol-2-imine is sourced from PubChem (CID 134935913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).