About CID 134935928
CID 134935928 (PubChem CID 134935928) has the molecular formula C11H9N2
and a molecular weight of 169.21 g/mol.
Molecular Properties
| Compound Name | CID 134935928 |
| PubChem CID | 134935928 |
| Molecular Formula | C11H9N2 |
| Molecular Weight | 169.21 g/mol |
| Exact Mass | 169.08 |
| IUPAC Name | — |
| SMILES | [CH]1[CH][CH][C](/N=N/c2ccccc2)[CH]1 |
| InChI | InChI=1S/C11H9N2/c1-2-6-10(7-3-1)12-13-11-8-4-5-9-11/h1-9H/b13-12+ |
| InChIKey | OEBKFBSCWMSNOH-OUKQBFOZSA-N |
| XLogP | 3.13 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.21 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze CID 134935928 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134935928?
The IUPAC name of CID 134935928 (CID 134935928) is not available.
What is the SMILES notation for CID 134935928?
The canonical SMILES for CID 134935928 is [CH]1[CH][CH][C](/N=N/c2ccccc2)[CH]1.
What is the InChIKey of CID 134935928?
The InChIKey is OEBKFBSCWMSNOH-OUKQBFOZSA-N. The full InChI is InChI=1S/C11H9N2/c1-2-6-10(7-3-1)12-13-11-8-4-5-9-11/h1-9H/b13-12+.
What are the key properties of CID 134935928?
CID 134935928 has a molecular weight of 169.21 g/mol, XLogP of 3.13, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134935928 is sourced from PubChem (CID 134935928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).