C12H10Br2O2 — CID 134936150
(1S,2S,3R,6S,7R,8R)-10,11-dibromo-12-oxatetracyclo[6.3.1.13,6.02,7]trideca-4,10-dien-9-one (PubChem CID 134936150) has the molecular formula C12H10Br2O2 and a molecular weight of 346.02 g/mol. Its IUPAC name is (1S,2S,3R,6S,7R,8R)-10,11-dibromo-12-oxatetracyclo[6.3.1.13,6.02,7]trideca-4,10-dien-9-one.
| Compound Name | (1S,2S,3R,6S,7R,8R)-10,11-dibromo-12-oxatetracyclo[6.3.1.13,6.02,7]trideca-4,10-dien-9-one |
|---|---|
| PubChem CID | 134936150 |
| Molecular Formula | C12H10Br2O2 |
| Molecular Weight | 346.02 g/mol |
| Exact Mass | 343.90 |
| IUPAC Name | (1S,2S,3R,6S,7R,8R)-10,11-dibromo-12-oxatetracyclo[6.3.1.13,6.02,7]trideca-4,10-dien-9-one |
| SMILES | O=C1C(Br)=C(Br)[C@H]2O[C@@H]1[C@H]1[C@@H]2[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C12H10Br2O2/c13-8-9(14)11-6-4-1-2-5(3-4)7(6)12(16-11)10(8)15/h1-2,4-7,11-12H,3H2/t4-,5+,6-,7+,11-,12+/m0/s1 |
| InChIKey | UEQSZHIAKQLUNN-UTWSAILVSA-N |
| XLogP | 2.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.02 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|