About (4S,6R)-4-bromo-6-ethoxy-3-naphthalen-2-yl-5,6-dihydro-4H-oxazine
(4S,6R)-4-bromo-6-ethoxy-3-naphthalen-2-yl-5,6-dihydro-4H-oxazine (PubChem CID 134936224) has the molecular formula C16H16BrNO2
and a molecular weight of 334.21 g/mol. Its IUPAC name is (4S,6R)-4-bromo-6-ethoxy-3-naphthalen-2-yl-5,6-dihydro-4H-oxazine.
Molecular Properties
| Compound Name | (4S,6R)-4-bromo-6-ethoxy-3-naphthalen-2-yl-5,6-dihydro-4H-oxazine |
| PubChem CID | 134936224 |
| Molecular Formula | C16H16BrNO2 |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | (4S,6R)-4-bromo-6-ethoxy-3-naphthalen-2-yl-5,6-dihydro-4H-oxazine |
| SMILES | CCO[C@H]1C[C@H](Br)C(c2ccc3ccccc3c2)=NO1 |
| InChI | InChI=1S/C16H16BrNO2/c1-2-19-15-10-14(17)16(18-20-15)13-8-7-11-5-3-4-6-12(11)9-13/h3-9,14-15H,2,10H2,1H3/t14-,15+/m0/s1 |
| InChIKey | MZSRJEKOMMMCOB-LSDHHAIUSA-N |
| XLogP | 4.09 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (4S,6R)-4-bromo-6-ethoxy-3-naphthalen-2-yl-5,6-dihydro-4H-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,6R)-4-bromo-6-ethoxy-3-naphthalen-2-yl-5,6-dihydro-4H-oxazine?
The IUPAC name of (4S,6R)-4-bromo-6-ethoxy-3-naphthalen-2-yl-5,6-dihydro-4H-oxazine (CID 134936224) is (4S,6R)-4-bromo-6-ethoxy-3-naphthalen-2-yl-5,6-dihydro-4H-oxazine.
What is the SMILES notation for (4S,6R)-4-bromo-6-ethoxy-3-naphthalen-2-yl-5,6-dihydro-4H-oxazine?
The canonical SMILES for (4S,6R)-4-bromo-6-ethoxy-3-naphthalen-2-yl-5,6-dihydro-4H-oxazine is CCO[C@H]1C[C@H](Br)C(c2ccc3ccccc3c2)=NO1.
What is the InChIKey of (4S,6R)-4-bromo-6-ethoxy-3-naphthalen-2-yl-5,6-dihydro-4H-oxazine?
The InChIKey is MZSRJEKOMMMCOB-LSDHHAIUSA-N. The full InChI is InChI=1S/C16H16BrNO2/c1-2-19-15-10-14(17)16(18-20-15)13-8-7-11-5-3-4-6-12(11)9-13/h3-9,14-15H,2,10H2,1H3/t14-,15+/m0/s1.
What are the key properties of (4S,6R)-4-bromo-6-ethoxy-3-naphthalen-2-yl-5,6-dihydro-4H-oxazine?
(4S,6R)-4-bromo-6-ethoxy-3-naphthalen-2-yl-5,6-dihydro-4H-oxazine has a molecular weight of 334.21 g/mol, XLogP of 4.09, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,6R)-4-bromo-6-ethoxy-3-naphthalen-2-yl-5,6-dihydro-4H-oxazine is sourced from PubChem (CID 134936224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).