C20H44O3Si — CID 134936231
(2R,4R,5S,6S)-2,4,6-trimethyl-5-tri(propan-2-yl)silyloxyoctane-1,3-diol (PubChem CID 134936231) has the molecular formula C20H44O3Si and a molecular weight of 360.66 g/mol. Its IUPAC name is (2R,4R,5S,6S)-2,4,6-trimethyl-5-tri(propan-2-yl)silyloxyoctane-1,3-diol.
| Compound Name | (2R,4R,5S,6S)-2,4,6-trimethyl-5-tri(propan-2-yl)silyloxyoctane-1,3-diol |
|---|---|
| PubChem CID | 134936231 |
| Molecular Formula | C20H44O3Si |
| Molecular Weight | 360.66 g/mol |
| Exact Mass | 360.31 |
| IUPAC Name | (2R,4R,5S,6S)-2,4,6-trimethyl-5-tri(propan-2-yl)silyloxyoctane-1,3-diol |
| SMILES | CC[C@H](C)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](C)C(O)[C@H](C)CO |
| InChI | InChI=1S/C20H44O3Si/c1-11-16(8)20(18(10)19(22)17(9)12-21)23-24(13(2)3,14(4)5)15(6)7/h13-22H,11-12H2,1-10H3/t16-,17+,18+,19?,20-/m0/s1 |
| InChIKey | ZRSVSIBCSKLPEJ-APYTWINISA-N |
| XLogP | 5.22 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.66 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|