About N-(2-amino-5-methyl-1,3-benzothiazol-6-yl)-2,2-dichloroacetamide
N-(2-amino-5-methyl-1,3-benzothiazol-6-yl)-2,2-dichloroacetamide (PubChem CID 134936381) has the molecular formula C10H9Cl2N3OS
and a molecular weight of 290.18 g/mol. Its IUPAC name is N-(2-amino-5-methyl-1,3-benzothiazol-6-yl)-2,2-dichloroacetamide.
Molecular Properties
| Compound Name | N-(2-amino-5-methyl-1,3-benzothiazol-6-yl)-2,2-dichloroacetamide |
| PubChem CID | 134936381 |
| Molecular Formula | C10H9Cl2N3OS |
| Molecular Weight | 290.18 g/mol |
| Exact Mass | 288.98 |
| IUPAC Name | N-(2-amino-5-methyl-1,3-benzothiazol-6-yl)-2,2-dichloroacetamide |
| SMILES | Cc1cc2nc(N)sc2cc1NC(=O)C(Cl)Cl |
| InChI | InChI=1S/C10H9Cl2N3OS/c1-4-2-6-7(17-10(13)15-6)3-5(4)14-9(16)8(11)12/h2-3,8H,1H3,(H2,13,15)(H,14,16) |
| InChIKey | LDPFQYUOCMLCLR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.18 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(2-amino-5-methyl-1,3-benzothiazol-6-yl)-2,2-dichloroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-amino-5-methyl-1,3-benzothiazol-6-yl)-2,2-dichloroacetamide?
The IUPAC name of N-(2-amino-5-methyl-1,3-benzothiazol-6-yl)-2,2-dichloroacetamide (CID 134936381) is N-(2-amino-5-methyl-1,3-benzothiazol-6-yl)-2,2-dichloroacetamide.
What is the SMILES notation for N-(2-amino-5-methyl-1,3-benzothiazol-6-yl)-2,2-dichloroacetamide?
The canonical SMILES for N-(2-amino-5-methyl-1,3-benzothiazol-6-yl)-2,2-dichloroacetamide is Cc1cc2nc(N)sc2cc1NC(=O)C(Cl)Cl.
What is the InChIKey of N-(2-amino-5-methyl-1,3-benzothiazol-6-yl)-2,2-dichloroacetamide?
The InChIKey is LDPFQYUOCMLCLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9Cl2N3OS/c1-4-2-6-7(17-10(13)15-6)3-5(4)14-9(16)8(11)12/h2-3,8H,1H3,(H2,13,15)(H,14,16).
What are the key properties of N-(2-amino-5-methyl-1,3-benzothiazol-6-yl)-2,2-dichloroacetamide?
N-(2-amino-5-methyl-1,3-benzothiazol-6-yl)-2,2-dichloroacetamide has a molecular weight of 290.18 g/mol, XLogP of 2.93, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-amino-5-methyl-1,3-benzothiazol-6-yl)-2,2-dichloroacetamide is sourced from PubChem (CID 134936381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).