C21H30O6S — CID 134936410
(3R)-3-[(4R,5S,6R)-5-(methoxymethoxy)-6-(phenylsulfanylmethyl)-1,3-dioxan-4-yl]-1,4-dioxaspiro[4.5]decane (PubChem CID 134936410) has the molecular formula C21H30O6S and a molecular weight of 410.53 g/mol. Its IUPAC name is (3R)-3-[(4R,5S,6R)-5-(methoxymethoxy)-6-(phenylsulfanylmethyl)-1,3-dioxan-4-yl]-1,4-dioxaspiro[4.5]decane.
| Compound Name | (3R)-3-[(4R,5S,6R)-5-(methoxymethoxy)-6-(phenylsulfanylmethyl)-1,3-dioxan-4-yl]-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 134936410 |
| Molecular Formula | C21H30O6S |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | (3R)-3-[(4R,5S,6R)-5-(methoxymethoxy)-6-(phenylsulfanylmethyl)-1,3-dioxan-4-yl]-1,4-dioxaspiro[4.5]decane |
| SMILES | COCO[C@H]1[C@@H]([C@H]2COC3(CCCCC3)O2)OCO[C@H]1CSc1ccccc1 |
| InChI | InChI=1S/C21H30O6S/c1-22-14-24-20-18(13-28-16-8-4-2-5-9-16)23-15-25-19(20)17-12-26-21(27-17)10-6-3-7-11-21/h2,4-5,8-9,17-20H,3,6-7,10-15H2,1H3/t17-,18+,19-,20-/m1/s1 |
| InChIKey | SXRXMQMTDKEJPQ-IYWMVGAKSA-N |
| XLogP | 3.59 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|