C12H19NO2 — CID 134936534
(4R,6S)-6-ethyl-2,2-dimethyl-4-prop-2-enyl-1,3-dioxane-4-carbonitrile (PubChem CID 134936534) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is (4R,6S)-6-ethyl-2,2-dimethyl-4-prop-2-enyl-1,3-dioxane-4-carbonitrile.
| Compound Name | (4R,6S)-6-ethyl-2,2-dimethyl-4-prop-2-enyl-1,3-dioxane-4-carbonitrile |
|---|---|
| PubChem CID | 134936534 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | (4R,6S)-6-ethyl-2,2-dimethyl-4-prop-2-enyl-1,3-dioxane-4-carbonitrile |
| SMILES | C=CC[C@]1(C#N)C[C@H](CC)OC(C)(C)O1 |
| InChI | InChI=1S/C12H19NO2/c1-5-7-12(9-13)8-10(6-2)14-11(3,4)15-12/h5,10H,1,6-8H2,2-4H3/t10-,12+/m0/s1 |
| InChIKey | KEHMRMHZASKNLW-CMPLNLGQSA-N |
| XLogP | 2.78 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|