About trimethyl-[(2-methyl-3,6-dihydro-2H-pyran-4-yl)methyl]silane
trimethyl-[(2-methyl-3,6-dihydro-2H-pyran-4-yl)methyl]silane (PubChem CID 13493655) has the molecular formula C10H20OSi
and a molecular weight of 184.35 g/mol. Its IUPAC name is trimethyl-[(2-methyl-3,6-dihydro-2H-pyran-4-yl)methyl]silane.
Molecular Properties
| Compound Name | trimethyl-[(2-methyl-3,6-dihydro-2H-pyran-4-yl)methyl]silane |
| PubChem CID | 13493655 |
| Molecular Formula | C10H20OSi |
| Molecular Weight | 184.35 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | trimethyl-[(2-methyl-3,6-dihydro-2H-pyran-4-yl)methyl]silane |
| SMILES | CC1CC(C[Si](C)(C)C)=CCO1 |
| InChI | InChI=1S/C10H20OSi/c1-9-7-10(5-6-11-9)8-12(2,3)4/h5,9H,6-8H2,1-4H3 |
| InChIKey | WOUCLWIGYRWDRJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[(2-methyl-3,6-dihydro-2H-pyran-4-yl)methyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[(2-methyl-3,6-dihydro-2H-pyran-4-yl)methyl]silane?
The IUPAC name of trimethyl-[(2-methyl-3,6-dihydro-2H-pyran-4-yl)methyl]silane (CID 13493655) is trimethyl-[(2-methyl-3,6-dihydro-2H-pyran-4-yl)methyl]silane.
What is the SMILES notation for trimethyl-[(2-methyl-3,6-dihydro-2H-pyran-4-yl)methyl]silane?
The canonical SMILES for trimethyl-[(2-methyl-3,6-dihydro-2H-pyran-4-yl)methyl]silane is CC1CC(C[Si](C)(C)C)=CCO1.
What is the InChIKey of trimethyl-[(2-methyl-3,6-dihydro-2H-pyran-4-yl)methyl]silane?
The InChIKey is WOUCLWIGYRWDRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20OSi/c1-9-7-10(5-6-11-9)8-12(2,3)4/h5,9H,6-8H2,1-4H3.
What are the key properties of trimethyl-[(2-methyl-3,6-dihydro-2H-pyran-4-yl)methyl]silane?
trimethyl-[(2-methyl-3,6-dihydro-2H-pyran-4-yl)methyl]silane has a molecular weight of 184.35 g/mol, XLogP of 3.06, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[(2-methyl-3,6-dihydro-2H-pyran-4-yl)methyl]silane is sourced from PubChem (CID 13493655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).