C20H31FO5Si — CID 134936573
[(2S,4aS,7R,8S,8aS)-6-fluoro-7-methoxy-2-phenyl-3,4a,6,7,8,8a-hexahydro-2H-pyrano[2,3-b][1,4]dioxin-8-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 134936573) has the molecular formula C20H31FO5Si and a molecular weight of 398.55 g/mol. Its IUPAC name is [(2S,4aS,7R,8S,8aS)-6-fluoro-7-methoxy-2-phenyl-3,4a,6,7,8,8a-hexahydro-2H-pyrano[2,3-b][1,4]dioxin-8-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2S,4aS,7R,8S,8aS)-6-fluoro-7-methoxy-2-phenyl-3,4a,6,7,8,8a-hexahydro-2H-pyrano[2,3-b][1,4]dioxin-8-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134936573 |
| Molecular Formula | C20H31FO5Si |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | [(2S,4aS,7R,8S,8aS)-6-fluoro-7-methoxy-2-phenyl-3,4a,6,7,8,8a-hexahydro-2H-pyrano[2,3-b][1,4]dioxin-8-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CO[C@H]1C(F)O[C@@H]2OC[C@H](c3ccccc3)O[C@H]2[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H31FO5Si/c1-20(2,3)27(5,6)26-15-16(22-4)18(21)25-19-17(15)24-14(12-23-19)13-10-8-7-9-11-13/h7-11,14-19H,12H2,1-6H3/t14-,15-,16-,17+,18?,19+/m1/s1 |
| InChIKey | WXGHKGMRHMPWAM-AQTIYHOBSA-N |
| XLogP | 4.20 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|