C18H19ClO3S — CID 134936574
chloromethyl 2,3,5,6-tetramethyl-4-oxo-1-phenylsulfanylcyclohexa-2,5-diene-1-carboxylate (PubChem CID 134936574) has the molecular formula C18H19ClO3S and a molecular weight of 350.87 g/mol. Its IUPAC name is chloromethyl 2,3,5,6-tetramethyl-4-oxo-1-phenylsulfanylcyclohexa-2,5-diene-1-carboxylate.
| Compound Name | chloromethyl 2,3,5,6-tetramethyl-4-oxo-1-phenylsulfanylcyclohexa-2,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 134936574 |
| Molecular Formula | C18H19ClO3S |
| Molecular Weight | 350.87 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | chloromethyl 2,3,5,6-tetramethyl-4-oxo-1-phenylsulfanylcyclohexa-2,5-diene-1-carboxylate |
| SMILES | CC1=C(C)C(Sc2ccccc2)(C(=O)OCCl)C(C)=C(C)C1=O |
| InChI | InChI=1S/C18H19ClO3S/c1-11-13(3)18(17(21)22-10-19,14(4)12(2)16(11)20)23-15-8-6-5-7-9-15/h5-9H,10H2,1-4H3 |
| InChIKey | WOPZXBRAUMXDPN-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.87 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|