C20H36O4S2 — CID 134936659
tert-butyl 2-[(2S,4R)-4-[bis(ethylsulfanyl)methyl]-1,5-dioxaspiro[5.5]undecan-2-yl]acetate (PubChem CID 134936659) has the molecular formula C20H36O4S2 and a molecular weight of 404.64 g/mol. Its IUPAC name is tert-butyl 2-[(2S,4R)-4-[bis(ethylsulfanyl)methyl]-1,5-dioxaspiro[5.5]undecan-2-yl]acetate.
| Compound Name | tert-butyl 2-[(2S,4R)-4-[bis(ethylsulfanyl)methyl]-1,5-dioxaspiro[5.5]undecan-2-yl]acetate |
|---|---|
| PubChem CID | 134936659 |
| Molecular Formula | C20H36O4S2 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | tert-butyl 2-[(2S,4R)-4-[bis(ethylsulfanyl)methyl]-1,5-dioxaspiro[5.5]undecan-2-yl]acetate |
| SMILES | CCSC(SCC)[C@H]1C[C@@H](CC(=O)OC(C)(C)C)OC2(CCCCC2)O1 |
| InChI | InChI=1S/C20H36O4S2/c1-6-25-18(26-7-2)16-13-15(14-17(21)24-19(3,4)5)22-20(23-16)11-9-8-10-12-20/h15-16,18H,6-14H2,1-5H3/t15-,16+/m0/s1 |
| InChIKey | SPLUZRIOHCRQIE-JKSUJKDBSA-N |
| XLogP | 5.39 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|