About 10-methoxy-1,5-dioxaspiro[5.5]undeca-7,10-dien-9-one
10-methoxy-1,5-dioxaspiro[5.5]undeca-7,10-dien-9-one (PubChem CID 134936660) has the molecular formula C10H12O4
and a molecular weight of 196.20 g/mol. Its IUPAC name is 10-methoxy-1,5-dioxaspiro[5.5]undeca-7,10-dien-9-one.
Molecular Properties
| Compound Name | 10-methoxy-1,5-dioxaspiro[5.5]undeca-7,10-dien-9-one |
| PubChem CID | 134936660 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 10-methoxy-1,5-dioxaspiro[5.5]undeca-7,10-dien-9-one |
| SMILES | COC1=CC2(C=CC1=O)OCCCO2 |
| InChI | InChI=1S/C10H12O4/c1-12-9-7-10(4-3-8(9)11)13-5-2-6-14-10/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | MPRFDPJKJNCJQK-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 10-methoxy-1,5-dioxaspiro[5.5]undeca-7,10-dien-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methoxy-1,5-dioxaspiro[5.5]undeca-7,10-dien-9-one?
The IUPAC name of 10-methoxy-1,5-dioxaspiro[5.5]undeca-7,10-dien-9-one (CID 134936660) is 10-methoxy-1,5-dioxaspiro[5.5]undeca-7,10-dien-9-one.
What is the SMILES notation for 10-methoxy-1,5-dioxaspiro[5.5]undeca-7,10-dien-9-one?
The canonical SMILES for 10-methoxy-1,5-dioxaspiro[5.5]undeca-7,10-dien-9-one is COC1=CC2(C=CC1=O)OCCCO2.
What is the InChIKey of 10-methoxy-1,5-dioxaspiro[5.5]undeca-7,10-dien-9-one?
The InChIKey is MPRFDPJKJNCJQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O4/c1-12-9-7-10(4-3-8(9)11)13-5-2-6-14-10/h3-4,7H,2,5-6H2,1H3.
What are the key properties of 10-methoxy-1,5-dioxaspiro[5.5]undeca-7,10-dien-9-one?
10-methoxy-1,5-dioxaspiro[5.5]undeca-7,10-dien-9-one has a molecular weight of 196.20 g/mol, XLogP of 0.79, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methoxy-1,5-dioxaspiro[5.5]undeca-7,10-dien-9-one is sourced from PubChem (CID 134936660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).