C19H17ClF4O3S — CID 134936720
chloromethyl 2,3,5,6-tetramethyl-4-oxo-1-(2,3,5,6-tetrafluoro-4-methylphenyl)sulfanylcyclohexa-2,5-diene-1-carboxylate (PubChem CID 134936720) has the molecular formula C19H17ClF4O3S and a molecular weight of 436.85 g/mol. Its IUPAC name is chloromethyl 2,3,5,6-tetramethyl-4-oxo-1-(2,3,5,6-tetrafluoro-4-methylphenyl)sulfanylcyclohexa-2,5-diene-1-carboxylate.
| Compound Name | chloromethyl 2,3,5,6-tetramethyl-4-oxo-1-(2,3,5,6-tetrafluoro-4-methylphenyl)sulfanylcyclohexa-2,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 134936720 |
| Molecular Formula | C19H17ClF4O3S |
| Molecular Weight | 436.85 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | chloromethyl 2,3,5,6-tetramethyl-4-oxo-1-(2,3,5,6-tetrafluoro-4-methylphenyl)sulfanylcyclohexa-2,5-diene-1-carboxylate |
| SMILES | CC1=C(C)C(Sc2c(F)c(F)c(C)c(F)c2F)(C(=O)OCCl)C(C)=C(C)C1=O |
| InChI | InChI=1S/C19H17ClF4O3S/c1-7-10(4)19(18(26)27-6-20,11(5)8(2)16(7)25)28-17-14(23)12(21)9(3)13(22)15(17)24/h6H2,1-5H3 |
| InChIKey | PUMZRCCPIIUMRL-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.85 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|