C32H43NO9Si — CID 134936744
ethyl (3S,5R)-2-[(3aR,4R,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5-acetyloxy-1,2-oxazolidine-3-carboxylate (PubChem CID 134936744) has the molecular formula C32H43NO9Si and a molecular weight of 613.78 g/mol. Its IUPAC name is ethyl (3S,5R)-2-[(3aR,4R,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5-acetyloxy-1,2-oxazolidine-3-carboxylate.
| Compound Name | ethyl (3S,5R)-2-[(3aR,4R,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5-acetyloxy-1,2-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 134936744 |
| Molecular Formula | C32H43NO9Si |
| Molecular Weight | 613.78 g/mol |
| Exact Mass | 613.27 |
| IUPAC Name | ethyl (3S,5R)-2-[(3aR,4R,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5-acetyloxy-1,2-oxazolidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@H](OC(C)=O)ON1[C@@H]1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C32H43NO9Si/c1-8-36-30(35)24-19-26(38-21(2)34)42-33(24)29-28-27(40-32(6,7)41-28)25(39-29)20-37-43(31(3,4)5,22-15-11-9-12-16-22)23-17-13-10-14-18-23/h9-18,24-29H,8,19-20H2,1-7H3/t24-,25+,26+,27+,28+,29+/m0/s1 |
| InChIKey | XSOOMJQEIYAVRP-ZHMMVFJOSA-N |
| XLogP | 3.27 |
| TPSA | 101.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.78 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|