C21H42O3Si — CID 134936781
tert-butyl-[(2R)-2,6-dimethyl-2-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]hept-5-enoxy]-dimethylsilane (PubChem CID 134936781) has the molecular formula C21H42O3Si and a molecular weight of 370.65 g/mol. Its IUPAC name is tert-butyl-[(2R)-2,6-dimethyl-2-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]hept-5-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2R)-2,6-dimethyl-2-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]hept-5-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134936781 |
| Molecular Formula | C21H42O3Si |
| Molecular Weight | 370.65 g/mol |
| Exact Mass | 370.29 |
| IUPAC Name | tert-butyl-[(2R)-2,6-dimethyl-2-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]hept-5-enoxy]-dimethylsilane |
| SMILES | CC(C)=CCC[C@](C)(CCC1(C)OCCO1)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H42O3Si/c1-18(2)11-10-12-20(6,13-14-21(7)22-15-16-23-21)17-24-25(8,9)19(3,4)5/h11H,10,12-17H2,1-9H3/t20-/m1/s1 |
| InChIKey | UJKOYYDULNHIHZ-HXUWFJFHSA-N |
| XLogP | 6.30 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.65 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|