C17H26S2 — CID 134936870
7,11,14,14-tetramethyl-1,4-dithiadispiro[4.2.58.25]pentadeca-6,10-diene (PubChem CID 134936870) has the molecular formula C17H26S2 and a molecular weight of 294.53 g/mol. Its IUPAC name is 7,11,14,14-tetramethyl-1,4-dithiadispiro[4.2.58.25]pentadeca-6,10-diene.
| Compound Name | 7,11,14,14-tetramethyl-1,4-dithiadispiro[4.2.58.25]pentadeca-6,10-diene |
|---|---|
| PubChem CID | 134936870 |
| Molecular Formula | C17H26S2 |
| Molecular Weight | 294.53 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 7,11,14,14-tetramethyl-1,4-dithiadispiro[4.2.58.25]pentadeca-6,10-diene |
| SMILES | CC1=CCC2(CC1)C(C)=CC1(CC2(C)C)SCCS1 |
| InChI | InChI=1S/C17H26S2/c1-13-5-7-16(8-6-13)14(2)11-17(12-15(16,3)4)18-9-10-19-17/h5,11H,6-10,12H2,1-4H3 |
| InChIKey | YCQQDTFPIAKXGB-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.53 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|