C17H17F2NO — CID 134936950
N-[2,2-difluoro-1-(4-methylphenyl)-2-phenylethyl]acetamide (PubChem CID 134936950) has the molecular formula C17H17F2NO and a molecular weight of 289.33 g/mol. Its IUPAC name is N-[2,2-difluoro-1-(4-methylphenyl)-2-phenylethyl]acetamide.
| Compound Name | N-[2,2-difluoro-1-(4-methylphenyl)-2-phenylethyl]acetamide |
|---|---|
| PubChem CID | 134936950 |
| Molecular Formula | C17H17F2NO |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | N-[2,2-difluoro-1-(4-methylphenyl)-2-phenylethyl]acetamide |
| SMILES | CC(=O)NC(c1ccc(C)cc1)C(F)(F)c1ccccc1 |
| InChI | InChI=1S/C17H17F2NO/c1-12-8-10-14(11-9-12)16(20-13(2)21)17(18,19)15-6-4-3-5-7-15/h3-11,16H,1-2H3,(H,20,21) |
| InChIKey | VHFGAVYHEYBWEQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |