C17H31BrO5Si — CID 134936980
[(3aR,4R,6S,7R,7aS)-6-bromo-2,2-dimethyl-7-prop-2-enoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 134936980) has the molecular formula C17H31BrO5Si and a molecular weight of 423.42 g/mol. Its IUPAC name is [(3aR,4R,6S,7R,7aS)-6-bromo-2,2-dimethyl-7-prop-2-enoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aR,4R,6S,7R,7aS)-6-bromo-2,2-dimethyl-7-prop-2-enoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134936980 |
| Molecular Formula | C17H31BrO5Si |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | [(3aR,4R,6S,7R,7aS)-6-bromo-2,2-dimethyl-7-prop-2-enoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=CCO[C@@H]1[C@H]2OC(C)(C)O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)O[C@H]1Br |
| InChI | InChI=1S/C17H31BrO5Si/c1-9-10-19-12-11-13(22-17(5,6)21-11)15(20-14(12)18)23-24(7,8)16(2,3)4/h9,11-15H,1,10H2,2-8H3/t11-,12-,13-,14-,15-/m1/s1 |
| InChIKey | HQHDXHFZYLFQHM-KJWHEZOQSA-N |
| XLogP | 4.18 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|