C22H32O5S — CID 134937063
[(2R)-2-[(7R,8S)-8-methyl-9-prop-1-en-2-yl-6,10-dioxaspiro[4.5]decan-7-yl]propyl] 4-methylbenzenesulfonate (PubChem CID 134937063) has the molecular formula C22H32O5S and a molecular weight of 408.56 g/mol. Its IUPAC name is [(2R)-2-[(7R,8S)-8-methyl-9-prop-1-en-2-yl-6,10-dioxaspiro[4.5]decan-7-yl]propyl] 4-methylbenzenesulfonate.
| Compound Name | [(2R)-2-[(7R,8S)-8-methyl-9-prop-1-en-2-yl-6,10-dioxaspiro[4.5]decan-7-yl]propyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134937063 |
| Molecular Formula | C22H32O5S |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | [(2R)-2-[(7R,8S)-8-methyl-9-prop-1-en-2-yl-6,10-dioxaspiro[4.5]decan-7-yl]propyl] 4-methylbenzenesulfonate |
| SMILES | C=C(C)C1OC2(CCCC2)O[C@H]([C@H](C)COS(=O)(=O)c2ccc(C)cc2)[C@@H]1C |
| InChI | InChI=1S/C22H32O5S/c1-15(2)20-18(5)21(27-22(26-20)12-6-7-13-22)17(4)14-25-28(23,24)19-10-8-16(3)9-11-19/h8-11,17-18,20-21H,1,6-7,12-14H2,2-5H3/t17-,18-,20?,21-/m1/s1 |
| InChIKey | BTGCOPDFTXIVPL-IDCIOKQTSA-N |
| XLogP | 4.60 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|