About (1-diethoxyphosphoryl-3,3-diethoxypropyl)benzene
(1-diethoxyphosphoryl-3,3-diethoxypropyl)benzene (PubChem CID 134937080) has the molecular formula C17H29O5P
and a molecular weight of 344.39 g/mol. Its IUPAC name is (1-diethoxyphosphoryl-3,3-diethoxypropyl)benzene.
Molecular Properties
| Compound Name | (1-diethoxyphosphoryl-3,3-diethoxypropyl)benzene |
| PubChem CID | 134937080 |
| Molecular Formula | C17H29O5P |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | (1-diethoxyphosphoryl-3,3-diethoxypropyl)benzene |
| SMILES | CCOC(CC(c1ccccc1)P(=O)(OCC)OCC)OCC |
| InChI | InChI=1S/C17H29O5P/c1-5-19-17(20-6-2)14-16(15-12-10-9-11-13-15)23(18,21-7-3)22-8-4/h9-13,16-17H,5-8,14H2,1-4H3 |
| InChIKey | MATLLJSDORBDGC-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (1-diethoxyphosphoryl-3,3-diethoxypropyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-diethoxyphosphoryl-3,3-diethoxypropyl)benzene?
The IUPAC name of (1-diethoxyphosphoryl-3,3-diethoxypropyl)benzene (CID 134937080) is (1-diethoxyphosphoryl-3,3-diethoxypropyl)benzene.
What is the SMILES notation for (1-diethoxyphosphoryl-3,3-diethoxypropyl)benzene?
The canonical SMILES for (1-diethoxyphosphoryl-3,3-diethoxypropyl)benzene is CCOC(CC(c1ccccc1)P(=O)(OCC)OCC)OCC.
What is the InChIKey of (1-diethoxyphosphoryl-3,3-diethoxypropyl)benzene?
The InChIKey is MATLLJSDORBDGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29O5P/c1-5-19-17(20-6-2)14-16(15-12-10-9-11-13-15)23(18,21-7-3)22-8-4/h9-13,16-17H,5-8,14H2,1-4H3.
What are the key properties of (1-diethoxyphosphoryl-3,3-diethoxypropyl)benzene?
(1-diethoxyphosphoryl-3,3-diethoxypropyl)benzene has a molecular weight of 344.39 g/mol, XLogP of 4.78, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-diethoxyphosphoryl-3,3-diethoxypropyl)benzene is sourced from PubChem (CID 134937080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).