C11H3F20I — CID 134937084
1,1,1,2,2,3,3,7,8,8,8-undecafluoro-5-iodo-4,4,7-tris(trifluoromethyl)octane (PubChem CID 134937084) has the molecular formula C11H3F20I and a molecular weight of 642.01 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,7,8,8,8-undecafluoro-5-iodo-4,4,7-tris(trifluoromethyl)octane.
| Compound Name | 1,1,1,2,2,3,3,7,8,8,8-undecafluoro-5-iodo-4,4,7-tris(trifluoromethyl)octane |
|---|---|
| PubChem CID | 134937084 |
| Molecular Formula | C11H3F20I |
| Molecular Weight | 642.01 g/mol |
| Exact Mass | 641.90 |
| IUPAC Name | 1,1,1,2,2,3,3,7,8,8,8-undecafluoro-5-iodo-4,4,7-tris(trifluoromethyl)octane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(C(I)CC(F)(C(F)(F)F)C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H3F20I/c12-3(7(17,18)19,8(20,21)22)1-2(32)4(9(23,24)25,10(26,27)28)5(13,14)6(15,16)11(29,30)31/h2H,1H2 |
| InChIKey | YOCAIFZOXIULCW-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.01 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|