C22H23ClO3S — CID 134937108
chloromethyl 2,6-dimethyl-4-oxo-1-phenylsulfanyl-3,5-bis(prop-2-enyl)cyclohexa-2,5-diene-1-carboxylate (PubChem CID 134937108) has the molecular formula C22H23ClO3S and a molecular weight of 402.94 g/mol. Its IUPAC name is chloromethyl 2,6-dimethyl-4-oxo-1-phenylsulfanyl-3,5-bis(prop-2-enyl)cyclohexa-2,5-diene-1-carboxylate.
| Compound Name | chloromethyl 2,6-dimethyl-4-oxo-1-phenylsulfanyl-3,5-bis(prop-2-enyl)cyclohexa-2,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 134937108 |
| Molecular Formula | C22H23ClO3S |
| Molecular Weight | 402.94 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | chloromethyl 2,6-dimethyl-4-oxo-1-phenylsulfanyl-3,5-bis(prop-2-enyl)cyclohexa-2,5-diene-1-carboxylate |
| SMILES | C=CCC1=C(C)C(Sc2ccccc2)(C(=O)OCCl)C(C)=C(CC=C)C1=O |
| InChI | InChI=1S/C22H23ClO3S/c1-5-10-18-15(3)22(21(25)26-14-23,27-17-12-8-7-9-13-17)16(4)19(11-6-2)20(18)24/h5-9,12-13H,1-2,10-11,14H2,3-4H3 |
| InChIKey | BBFGZVTYIWCWFG-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.94 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|