C37H58O7Si2 — CID 134937175
(1S,3R,5S,6R,8S,9S,10R)-5-[tert-butyl(dimethyl)silyl]oxy-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-12,12-dimethyl-2,7,11,13-tetraoxatricyclo[8.5.0.03,8]pentadecan-9-ol (PubChem CID 134937175) has the molecular formula C37H58O7Si2 and a molecular weight of 671.04 g/mol. Its IUPAC name is (1S,3R,5S,6R,8S,9S,10R)-5-[tert-butyl(dimethyl)silyl]oxy-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-12,12-dimethyl-2,7,11,13-tetraoxatricyclo[8.5.0.03,8]pentadecan-9-ol.
| Compound Name | (1S,3R,5S,6R,8S,9S,10R)-5-[tert-butyl(dimethyl)silyl]oxy-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-12,12-dimethyl-2,7,11,13-tetraoxatricyclo[8.5.0.03,8]pentadecan-9-ol |
|---|---|
| PubChem CID | 134937175 |
| Molecular Formula | C37H58O7Si2 |
| Molecular Weight | 671.04 g/mol |
| Exact Mass | 670.37 |
| IUPAC Name | (1S,3R,5S,6R,8S,9S,10R)-5-[tert-butyl(dimethyl)silyl]oxy-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-12,12-dimethyl-2,7,11,13-tetraoxatricyclo[8.5.0.03,8]pentadecan-9-ol |
| SMILES | CC1(C)OCC[C@@H]2O[C@@H]3C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CCO[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)O[C@H]3[C@H](O)[C@H]2O1 |
| InChI | InChI=1S/C37H58O7Si2/c1-35(2,3)45(9,10)44-30-25-31-33(32(38)34-29(41-31)21-23-39-37(7,8)43-34)42-28(30)22-24-40-46(36(4,5)6,26-17-13-11-14-18-26)27-19-15-12-16-20-27/h11-20,28-34,38H,21-25H2,1-10H3/t28-,29+,30+,31-,32+,33-,34+/m1/s1 |
| InChIKey | CSWOEADQNPQICW-NJOUYUIJSA-N |
| XLogP | 6.17 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.04 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|