C21H32O10 — CID 134937286
[(3aR,5R,6R,7S,7aR)-6,7-diacetyloxy-2-(cyclohexylmethoxy)-2-methyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]methyl acetate (PubChem CID 134937286) has the molecular formula C21H32O10 and a molecular weight of 444.48 g/mol. Its IUPAC name is [(3aR,5R,6R,7S,7aR)-6,7-diacetyloxy-2-(cyclohexylmethoxy)-2-methyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]methyl acetate.
| Compound Name | [(3aR,5R,6R,7S,7aR)-6,7-diacetyloxy-2-(cyclohexylmethoxy)-2-methyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]methyl acetate |
|---|---|
| PubChem CID | 134937286 |
| Molecular Formula | C21H32O10 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | [(3aR,5R,6R,7S,7aR)-6,7-diacetyloxy-2-(cyclohexylmethoxy)-2-methyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H]2OC(C)(OCC3CCCCC3)O[C@@H]2[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H32O10/c1-12(22)25-11-16-17(27-13(2)23)18(28-14(3)24)19-20(29-16)31-21(4,30-19)26-10-15-8-6-5-7-9-15/h15-20H,5-11H2,1-4H3/t16-,17-,18+,19-,20-,21?/m1/s1 |
| InChIKey | AWTLXZTVCZVLGG-AVZCSXTLSA-N |
| XLogP | 1.82 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|