About chloromethyl 2,6-dimethyl-4-oxo-1-phenylsulfanylcyclohexa-2,5-diene-1-carboxylate
chloromethyl 2,6-dimethyl-4-oxo-1-phenylsulfanylcyclohexa-2,5-diene-1-carboxylate (PubChem CID 134937445) has the molecular formula C16H15ClO3S
and a molecular weight of 322.81 g/mol. Its IUPAC name is chloromethyl 2,6-dimethyl-4-oxo-1-phenylsulfanylcyclohexa-2,5-diene-1-carboxylate.
Molecular Properties
| Compound Name | chloromethyl 2,6-dimethyl-4-oxo-1-phenylsulfanylcyclohexa-2,5-diene-1-carboxylate |
| PubChem CID | 134937445 |
| Molecular Formula | C16H15ClO3S |
| Molecular Weight | 322.81 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | chloromethyl 2,6-dimethyl-4-oxo-1-phenylsulfanylcyclohexa-2,5-diene-1-carboxylate |
| SMILES | CC1=CC(=O)C=C(C)C1(Sc1ccccc1)C(=O)OCCl |
| InChI | InChI=1S/C16H15ClO3S/c1-11-8-13(18)9-12(2)16(11,15(19)20-10-17)21-14-6-4-3-5-7-14/h3-9H,10H2,1-2H3 |
| InChIKey | FXFHALFHCJYVIW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.81 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloromethyl 2,6-dimethyl-4-oxo-1-phenylsulfanylcyclohexa-2,5-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethyl 2,6-dimethyl-4-oxo-1-phenylsulfanylcyclohexa-2,5-diene-1-carboxylate?
The IUPAC name of chloromethyl 2,6-dimethyl-4-oxo-1-phenylsulfanylcyclohexa-2,5-diene-1-carboxylate (CID 134937445) is chloromethyl 2,6-dimethyl-4-oxo-1-phenylsulfanylcyclohexa-2,5-diene-1-carboxylate.
What is the SMILES notation for chloromethyl 2,6-dimethyl-4-oxo-1-phenylsulfanylcyclohexa-2,5-diene-1-carboxylate?
The canonical SMILES for chloromethyl 2,6-dimethyl-4-oxo-1-phenylsulfanylcyclohexa-2,5-diene-1-carboxylate is CC1=CC(=O)C=C(C)C1(Sc1ccccc1)C(=O)OCCl.
What is the InChIKey of chloromethyl 2,6-dimethyl-4-oxo-1-phenylsulfanylcyclohexa-2,5-diene-1-carboxylate?
The InChIKey is FXFHALFHCJYVIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15ClO3S/c1-11-8-13(18)9-12(2)16(11,15(19)20-10-17)21-14-6-4-3-5-7-14/h3-9H,10H2,1-2H3.
What are the key properties of chloromethyl 2,6-dimethyl-4-oxo-1-phenylsulfanylcyclohexa-2,5-diene-1-carboxylate?
chloromethyl 2,6-dimethyl-4-oxo-1-phenylsulfanylcyclohexa-2,5-diene-1-carboxylate has a molecular weight of 322.81 g/mol, XLogP of 3.73, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethyl 2,6-dimethyl-4-oxo-1-phenylsulfanylcyclohexa-2,5-diene-1-carboxylate is sourced from PubChem (CID 134937445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).