C22H34N4O7Si — CID 134937463
[(2R,4aR,7S,8R,8aR)-7-azido-2-phenyl-8-tri(propan-2-yl)silyloxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] nitrate (PubChem CID 134937463) has the molecular formula C22H34N4O7Si and a molecular weight of 494.62 g/mol. Its IUPAC name is [(2R,4aR,7S,8R,8aR)-7-azido-2-phenyl-8-tri(propan-2-yl)silyloxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] nitrate.
| Compound Name | [(2R,4aR,7S,8R,8aR)-7-azido-2-phenyl-8-tri(propan-2-yl)silyloxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] nitrate |
|---|---|
| PubChem CID | 134937463 |
| Molecular Formula | C22H34N4O7Si |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | [(2R,4aR,7S,8R,8aR)-7-azido-2-phenyl-8-tri(propan-2-yl)silyloxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] nitrate |
| SMILES | CC(C)[Si](O[C@H]1[C@@H]2O[C@H](c3ccccc3)OC[C@H]2OC(O[N+](=O)[O-])[C@H]1N=[N+]=[N-])(C(C)C)C(C)C |
| InChI | InChI=1S/C22H34N4O7Si/c1-13(2)34(14(3)4,15(5)6)33-20-18(24-25-23)22(32-26(27)28)30-17-12-29-21(31-19(17)20)16-10-8-7-9-11-16/h7-11,13-15,17-22H,12H2,1-6H3/t17-,18+,19-,20-,21-,22?/m1/s1 |
| InChIKey | KVBUNTFDYMJSHC-YGLZHXLNSA-N |
| XLogP | 5.27 |
| TPSA | 138.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|