C25H26N2O3S — CID 134937494
4-methyl-N'-(4-methylphenyl)sulfonyl-N-(2,3,5,6-tetramethyl-4-oxocyclohexa-2,5-dien-1-ylidene)benzenecarboximidamide (PubChem CID 134937494) has the molecular formula C25H26N2O3S and a molecular weight of 434.56 g/mol. Its IUPAC name is 4-methyl-N'-(4-methylphenyl)sulfonyl-N-(2,3,5,6-tetramethyl-4-oxocyclohexa-2,5-dien-1-ylidene)benzenecarboximidamide.
| Compound Name | 4-methyl-N'-(4-methylphenyl)sulfonyl-N-(2,3,5,6-tetramethyl-4-oxocyclohexa-2,5-dien-1-ylidene)benzenecarboximidamide |
|---|---|
| PubChem CID | 134937494 |
| Molecular Formula | C25H26N2O3S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 4-methyl-N'-(4-methylphenyl)sulfonyl-N-(2,3,5,6-tetramethyl-4-oxocyclohexa-2,5-dien-1-ylidene)benzenecarboximidamide |
| SMILES | CC1=C(C)C(=N/C(=N/S(=O)(=O)c2ccc(C)cc2)c2ccc(C)cc2)C(C)=C(C)C1=O |
| InChI | InChI=1S/C25H26N2O3S/c1-15-7-11-21(12-8-15)25(27-31(29,30)22-13-9-16(2)10-14-22)26-23-17(3)19(5)24(28)20(6)18(23)4/h7-14H,1-6H3/b27-25+ |
| InChIKey | MRZNBIPWHKUGCN-IMVLJIQESA-N |
| XLogP | 5.14 |
| TPSA | 75.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|