C37H49N3O4 — CID 134937512
(2R,3R,5R)-5-azido-1,3,4-tris(phenylmethoxy)hexadec-15-en-2-ol (PubChem CID 134937512) has the molecular formula C37H49N3O4 and a molecular weight of 599.82 g/mol. Its IUPAC name is (2R,3R,5R)-5-azido-1,3,4-tris(phenylmethoxy)hexadec-15-en-2-ol.
| Compound Name | (2R,3R,5R)-5-azido-1,3,4-tris(phenylmethoxy)hexadec-15-en-2-ol |
|---|---|
| PubChem CID | 134937512 |
| Molecular Formula | C37H49N3O4 |
| Molecular Weight | 599.82 g/mol |
| Exact Mass | 599.37 |
| IUPAC Name | (2R,3R,5R)-5-azido-1,3,4-tris(phenylmethoxy)hexadec-15-en-2-ol |
| SMILES | C=CCCCCCCCCC[C@@H](N=[N+]=[N-])C(OCc1ccccc1)[C@H](OCc1ccccc1)[C@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C37H49N3O4/c1-2-3-4-5-6-7-8-9-19-26-34(39-40-38)36(43-28-32-22-15-11-16-23-32)37(44-29-33-24-17-12-18-25-33)35(41)30-42-27-31-20-13-10-14-21-31/h2,10-18,20-25,34-37,41H,1,3-9,19,26-30H2/t34-,35-,36?,37-/m1/s1 |
| InChIKey | BYVPGJSKJVGMLW-SHBHGGNHSA-N |
| XLogP | 9.11 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.82 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|