C11H21NO2 — CID 134937664
N-methyl-N-[(2R,3R)-2,4,4-trimethyl-1-oxopentan-3-yl]acetamide (PubChem CID 134937664) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is N-methyl-N-[(2R,3R)-2,4,4-trimethyl-1-oxopentan-3-yl]acetamide.
| Compound Name | N-methyl-N-[(2R,3R)-2,4,4-trimethyl-1-oxopentan-3-yl]acetamide |
|---|---|
| PubChem CID | 134937664 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | N-methyl-N-[(2R,3R)-2,4,4-trimethyl-1-oxopentan-3-yl]acetamide |
| SMILES | CC(=O)N(C)[C@H]([C@@H](C)C=O)C(C)(C)C |
| InChI | InChI=1S/C11H21NO2/c1-8(7-13)10(11(3,4)5)12(6)9(2)14/h7-8,10H,1-6H3/t8-,10+/m0/s1 |
| InChIKey | VPMUPNHGZZUELS-WCBMZHEXSA-N |
| XLogP | 1.71 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|