C17H26O5 — CID 134937698
(1S,2R,6R,7R)-3-nonanoyl-8,9,10-trioxatricyclo[5.2.1.02,6]decane-4-carbaldehyde (PubChem CID 134937698) has the molecular formula C17H26O5 and a molecular weight of 310.39 g/mol. Its IUPAC name is (1S,2R,6R,7R)-3-nonanoyl-8,9,10-trioxatricyclo[5.2.1.02,6]decane-4-carbaldehyde.
| Compound Name | (1S,2R,6R,7R)-3-nonanoyl-8,9,10-trioxatricyclo[5.2.1.02,6]decane-4-carbaldehyde |
|---|---|
| PubChem CID | 134937698 |
| Molecular Formula | C17H26O5 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | (1S,2R,6R,7R)-3-nonanoyl-8,9,10-trioxatricyclo[5.2.1.02,6]decane-4-carbaldehyde |
| SMILES | CCCCCCCCC(=O)C1C(C=O)C[C@H]2[C@H]3OO[C@H](O3)[C@@H]12 |
| InChI | InChI=1S/C17H26O5/c1-2-3-4-5-6-7-8-13(19)14-11(10-18)9-12-15(14)17-20-16(12)21-22-17/h10-12,14-17H,2-9H2,1H3/t11?,12-,14?,15-,16-,17+/m1/s1 |
| InChIKey | MJCLYWHRSMFHPN-YSMPQMARSA-N |
| XLogP | 3.02 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|