C14H24O4S2 — CID 134937723
(S)-[(3aS,4R,6aR)-4-methoxy-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-(1,3-dithian-2-yl)methanol (PubChem CID 134937723) has the molecular formula C14H24O4S2 and a molecular weight of 320.48 g/mol. Its IUPAC name is (S)-[(3aS,4R,6aR)-4-methoxy-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-(1,3-dithian-2-yl)methanol.
| Compound Name | (S)-[(3aS,4R,6aR)-4-methoxy-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-(1,3-dithian-2-yl)methanol |
|---|---|
| PubChem CID | 134937723 |
| Molecular Formula | C14H24O4S2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | (S)-[(3aS,4R,6aR)-4-methoxy-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-(1,3-dithian-2-yl)methanol |
| SMILES | CO[C@@H]1CC([C@H](O)C2SCCCS2)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C14H24O4S2/c1-14(2)17-11-8(7-9(16-3)12(11)18-14)10(15)13-19-5-4-6-20-13/h8-13,15H,4-7H2,1-3H3/t8?,9-,10+,11-,12+/m1/s1 |
| InChIKey | OSSGLZFNSYOTTA-FGLXMSFASA-N |
| XLogP | 2.10 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |