C25H31F3O2S2Si — CID 134937727
2-[(3S)-3-[tert-butyl(diphenyl)silyl]oxy-4,4,4-trifluorobutyl]-1,3-dithiane-2-carbaldehyde (PubChem CID 134937727) has the molecular formula C25H31F3O2S2Si and a molecular weight of 512.74 g/mol. Its IUPAC name is 2-[(3S)-3-[tert-butyl(diphenyl)silyl]oxy-4,4,4-trifluorobutyl]-1,3-dithiane-2-carbaldehyde.
| Compound Name | 2-[(3S)-3-[tert-butyl(diphenyl)silyl]oxy-4,4,4-trifluorobutyl]-1,3-dithiane-2-carbaldehyde |
|---|---|
| PubChem CID | 134937727 |
| Molecular Formula | C25H31F3O2S2Si |
| Molecular Weight | 512.74 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | 2-[(3S)-3-[tert-butyl(diphenyl)silyl]oxy-4,4,4-trifluorobutyl]-1,3-dithiane-2-carbaldehyde |
| SMILES | CC(C)(C)[Si](O[C@@H](CCC1(C=O)SCCCS1)C(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H31F3O2S2Si/c1-23(2,3)33(20-11-6-4-7-12-20,21-13-8-5-9-14-21)30-22(25(26,27)28)15-16-24(19-29)31-17-10-18-32-24/h4-9,11-14,19,22H,10,15-18H2,1-3H3/t22-/m0/s1 |
| InChIKey | SOHKBTICAFOYAC-QFIPXVFZSA-N |
| XLogP | 6.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.74 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|