C18H20O3S2 — CID 134937731
(2R,3S,5S)-3-(benzenesulfonyl)-2,5-dimethyl-3-phenylsulfanyloxolane (PubChem CID 134937731) has the molecular formula C18H20O3S2 and a molecular weight of 348.49 g/mol. Its IUPAC name is (2R,3S,5S)-3-(benzenesulfonyl)-2,5-dimethyl-3-phenylsulfanyloxolane.
| Compound Name | (2R,3S,5S)-3-(benzenesulfonyl)-2,5-dimethyl-3-phenylsulfanyloxolane |
|---|---|
| PubChem CID | 134937731 |
| Molecular Formula | C18H20O3S2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | (2R,3S,5S)-3-(benzenesulfonyl)-2,5-dimethyl-3-phenylsulfanyloxolane |
| SMILES | C[C@H]1C[C@](Sc2ccccc2)(S(=O)(=O)c2ccccc2)[C@@H](C)O1 |
| InChI | InChI=1S/C18H20O3S2/c1-14-13-18(15(2)21-14,22-16-9-5-3-6-10-16)23(19,20)17-11-7-4-8-12-17/h3-12,14-15H,13H2,1-2H3/t14-,15+,18-/m0/s1 |
| InChIKey | TXVYNJXJGGFYBJ-DAYGRLMNSA-N |
| XLogP | 4.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |