About N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-3-iodo-2,6-dimethoxybenzamide
N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-3-iodo-2,6-dimethoxybenzamide (PubChem CID 13493784) has the molecular formula C16H23IN2O3
and a molecular weight of 418.28 g/mol. Its IUPAC name is N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-3-iodo-2,6-dimethoxybenzamide.
Molecular Properties
| Compound Name | N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-3-iodo-2,6-dimethoxybenzamide |
| PubChem CID | 13493784 |
| Molecular Formula | C16H23IN2O3 |
| Molecular Weight | 418.28 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-3-iodo-2,6-dimethoxybenzamide |
| SMILES | CCN1CCC[C@H]1CNC(=O)c1c(OC)ccc(I)c1OC |
| InChI | InChI=1S/C16H23IN2O3/c1-4-19-9-5-6-11(19)10-18-16(20)14-13(21-2)8-7-12(17)15(14)22-3/h7-8,11H,4-6,9-10H2,1-3H3,(H,18,20)/t11-/m0/s1 |
| InChIKey | JJYGMNQCYKVCSO-NSHDSACASA-N |
| XLogP | 2.52 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-3-iodo-2,6-dimethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-3-iodo-2,6-dimethoxybenzamide?
The IUPAC name of N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-3-iodo-2,6-dimethoxybenzamide (CID 13493784) is N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-3-iodo-2,6-dimethoxybenzamide.
What is the SMILES notation for N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-3-iodo-2,6-dimethoxybenzamide?
The canonical SMILES for N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-3-iodo-2,6-dimethoxybenzamide is CCN1CCC[C@H]1CNC(=O)c1c(OC)ccc(I)c1OC.
What is the InChIKey of N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-3-iodo-2,6-dimethoxybenzamide?
The InChIKey is JJYGMNQCYKVCSO-NSHDSACASA-N. The full InChI is InChI=1S/C16H23IN2O3/c1-4-19-9-5-6-11(19)10-18-16(20)14-13(21-2)8-7-12(17)15(14)22-3/h7-8,11H,4-6,9-10H2,1-3H3,(H,18,20)/t11-/m0/s1.
What are the key properties of N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-3-iodo-2,6-dimethoxybenzamide?
N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-3-iodo-2,6-dimethoxybenzamide has a molecular weight of 418.28 g/mol, XLogP of 2.52, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-3-iodo-2,6-dimethoxybenzamide is sourced from PubChem (CID 13493784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).