C34H45NO5Si — CID 134937912
2-[(2R,4R,5R,6S)-6-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-5-methyl-2-phenyl-1,3-dioxan-4-yl]-N-methoxy-N-methylacetamide (PubChem CID 134937912) has the molecular formula C34H45NO5Si and a molecular weight of 575.82 g/mol. Its IUPAC name is 2-[(2R,4R,5R,6S)-6-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-5-methyl-2-phenyl-1,3-dioxan-4-yl]-N-methoxy-N-methylacetamide.
| Compound Name | 2-[(2R,4R,5R,6S)-6-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-5-methyl-2-phenyl-1,3-dioxan-4-yl]-N-methoxy-N-methylacetamide |
|---|---|
| PubChem CID | 134937912 |
| Molecular Formula | C34H45NO5Si |
| Molecular Weight | 575.82 g/mol |
| Exact Mass | 575.31 |
| IUPAC Name | 2-[(2R,4R,5R,6S)-6-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-5-methyl-2-phenyl-1,3-dioxan-4-yl]-N-methoxy-N-methylacetamide |
| SMILES | CON(C)C(=O)C[C@H]1O[C@@H](c2ccccc2)O[C@@H]([C@H](C)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]1C |
| InChI | InChI=1S/C34H45NO5Si/c1-25(24-38-41(34(3,4)5,28-19-13-9-14-20-28)29-21-15-10-16-22-29)32-26(2)30(23-31(36)35(6)37-7)39-33(40-32)27-17-11-8-12-18-27/h8-22,25-26,30,32-33H,23-24H2,1-7H3/t25-,26-,30-,32+,33-/m1/s1 |
| InChIKey | OTFDAXQVDRDLEW-NEHBKBHBSA-N |
| XLogP | 5.73 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.82 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|