C14H15ClOS — CID 134937921
(1R,3S,4R,5R)-5-chloro-3-phenylsulfanylbicyclo[2.2.2]octan-2-one (PubChem CID 134937921) has the molecular formula C14H15ClOS and a molecular weight of 266.79 g/mol. Its IUPAC name is (1R,3S,4R,5R)-5-chloro-3-phenylsulfanylbicyclo[2.2.2]octan-2-one.
| Compound Name | (1R,3S,4R,5R)-5-chloro-3-phenylsulfanylbicyclo[2.2.2]octan-2-one |
|---|---|
| PubChem CID | 134937921 |
| Molecular Formula | C14H15ClOS |
| Molecular Weight | 266.79 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | (1R,3S,4R,5R)-5-chloro-3-phenylsulfanylbicyclo[2.2.2]octan-2-one |
| SMILES | O=C1[C@@H]2CC[C@@H]([C@H](Cl)C2)[C@@H]1Sc1ccccc1 |
| InChI | InChI=1S/C14H15ClOS/c15-12-8-9-6-7-11(12)14(13(9)16)17-10-4-2-1-3-5-10/h1-5,9,11-12,14H,6-8H2/t9-,11+,12-,14+/m1/s1 |
| InChIKey | QHEZECZPQAZDMQ-LEKOTGGOSA-N |
| XLogP | 3.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.79 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|