C18H15F7O4S — CID 134937974
[(1S)-2,2,3,3,4,4,4-heptafluoro-1-phenylmethoxybutyl] 4-methylbenzenesulfonate (PubChem CID 134937974) has the molecular formula C18H15F7O4S and a molecular weight of 460.37 g/mol. Its IUPAC name is [(1S)-2,2,3,3,4,4,4-heptafluoro-1-phenylmethoxybutyl] 4-methylbenzenesulfonate.
| Compound Name | [(1S)-2,2,3,3,4,4,4-heptafluoro-1-phenylmethoxybutyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134937974 |
| Molecular Formula | C18H15F7O4S |
| Molecular Weight | 460.37 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | [(1S)-2,2,3,3,4,4,4-heptafluoro-1-phenylmethoxybutyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H](OCc2ccccc2)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H15F7O4S/c1-12-7-9-14(10-8-12)30(26,27)29-15(28-11-13-5-3-2-4-6-13)16(19,20)17(21,22)18(23,24)25/h2-10,15H,11H2,1H3/t15-/m0/s1 |
| InChIKey | KYSROTQGSZISNT-HNNXBMFYSA-N |
| XLogP | 5.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.37 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|