C16H30O5 — CID 134938024
(2R)-2-[(4S,5S,6R)-6-[(2S,4R,5R)-5-ethyl-2,4-dimethyl-1,3-dioxolan-4-yl]-2,5-dimethyl-1,3-dioxan-4-yl]propan-1-ol (PubChem CID 134938024) has the molecular formula C16H30O5 and a molecular weight of 302.41 g/mol. Its IUPAC name is (2R)-2-[(4S,5S,6R)-6-[(2S,4R,5R)-5-ethyl-2,4-dimethyl-1,3-dioxolan-4-yl]-2,5-dimethyl-1,3-dioxan-4-yl]propan-1-ol.
| Compound Name | (2R)-2-[(4S,5S,6R)-6-[(2S,4R,5R)-5-ethyl-2,4-dimethyl-1,3-dioxolan-4-yl]-2,5-dimethyl-1,3-dioxan-4-yl]propan-1-ol |
|---|---|
| PubChem CID | 134938024 |
| Molecular Formula | C16H30O5 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | (2R)-2-[(4S,5S,6R)-6-[(2S,4R,5R)-5-ethyl-2,4-dimethyl-1,3-dioxolan-4-yl]-2,5-dimethyl-1,3-dioxan-4-yl]propan-1-ol |
| SMILES | CC[C@H]1O[C@H](C)O[C@@]1(C)[C@@H]1OC(C)O[C@@H]([C@H](C)CO)[C@@H]1C |
| InChI | InChI=1S/C16H30O5/c1-7-13-16(6,21-12(5)18-13)15-10(3)14(9(2)8-17)19-11(4)20-15/h9-15,17H,7-8H2,1-6H3/t9-,10+,11?,12+,13-,14+,15-,16-/m1/s1 |
| InChIKey | PJOOPMAWCKEENC-ROIXCOAHSA-N |
| XLogP | 2.31 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |